C15H19NO5 — CID 129084809
[3-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol (PubChem CID 129084809) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [3-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol.
| Compound Name | [3-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol |
|---|---|
| PubChem CID | 129084809 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [3-(2-nitrophenyl)-1,4-dioxaspiro[4.5]decan-2-yl]methanol |
| SMILES | O=[N+]([O-])c1ccccc1C1OC2(CCCCC2)OC1CO |
| InChI | InChI=1S/C15H19NO5/c17-10-13-14(11-6-2-3-7-12(11)16(18)19)21-15(20-13)8-4-1-5-9-15/h2-3,6-7,13-14,17H,1,4-5,8-10H2 |
| InChIKey | ZWFKNTNMTSUXOI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|