C14H18N2O7S — CID 118151902
[(2R,3R)-3-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate (PubChem CID 118151902) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is [(2R,3R)-3-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3R)-3-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 118151902 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [(2R,3R)-3-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1OC2(CCCC2)O[C@@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O7S/c15-24(19,20)21-9-12-13(23-14(22-12)7-3-4-8-14)10-5-1-2-6-11(10)16(17)18/h1-2,5-6,12-13H,3-4,7-9H2,(H2,15,19,20)/t12-,13-/m1/s1 |
| InChIKey | PWLOBFIKXWTAKE-CHWSQXEVSA-N |
| XLogP | 1.54 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|