C15H17NO6 — CID 118379215
(2R,3S)-3-methyl-2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid (PubChem CID 118379215) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid.
| Compound Name | (2R,3S)-3-methyl-2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid |
|---|---|
| PubChem CID | 118379215 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2R,3S)-3-methyl-2-(2-nitrophenyl)-1,4-dioxaspiro[4.4]nonane-3-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)OC2(CCCC2)O[C@@H]1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17NO6/c1-14(13(17)18)12(21-15(22-14)8-4-5-9-15)10-6-2-3-7-11(10)16(19)20/h2-3,6-7,12H,4-5,8-9H2,1H3,(H,17,18)/t12-,14+/m1/s1 |
| InChIKey | SYIXFORWJGYCHR-OCCSQVGLSA-N |
| XLogP | 2.80 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|