C14H20N2O7S — CID 175002722
methyl N-[2,2-diethyl-5-(2-nitrophenyl)-1,3-dioxolan-4-yl]sulfamate (PubChem CID 175002722) has the molecular formula C14H20N2O7S and a molecular weight of 360.39 g/mol. Its IUPAC name is methyl N-[2,2-diethyl-5-(2-nitrophenyl)-1,3-dioxolan-4-yl]sulfamate.
| Compound Name | methyl N-[2,2-diethyl-5-(2-nitrophenyl)-1,3-dioxolan-4-yl]sulfamate |
|---|---|
| PubChem CID | 175002722 |
| Molecular Formula | C14H20N2O7S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | methyl N-[2,2-diethyl-5-(2-nitrophenyl)-1,3-dioxolan-4-yl]sulfamate |
| SMILES | CCC1(CC)OC(NS(=O)(=O)OC)C(c2ccccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C14H20N2O7S/c1-4-14(5-2)22-12(13(23-14)15-24(19,20)21-3)10-8-6-7-9-11(10)16(17)18/h6-9,12-13,15H,4-5H2,1-3H3 |
| InChIKey | CXOJDVJGKXHCPT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|