C21H20N2O6S — CID 21442893
methyl 2-methyl-5-methylsulfonyl-4-(2-nitrophenyl)-6-phenyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 21442893) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is methyl 2-methyl-5-methylsulfonyl-4-(2-nitrophenyl)-6-phenyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2-methyl-5-methylsulfonyl-4-(2-nitrophenyl)-6-phenyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 21442893 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | methyl 2-methyl-5-methylsulfonyl-4-(2-nitrophenyl)-6-phenyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(c2ccccc2)=C(S(C)(=O)=O)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20N2O6S/c1-13-17(21(24)29-2)18(15-11-7-8-12-16(15)23(25)26)20(30(3,27)28)19(22-13)14-9-5-4-6-10-14/h4-12,18,22H,1-3H3 |
| InChIKey | XWMFLRMEWZHZSP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|