C16H19N3O6S — CID 70514154
2-(hydroxymethyl)-N,6-dimethyl-5-methylsulfonyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxamide (PubChem CID 70514154) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N,6-dimethyl-5-methylsulfonyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxamide.
| Compound Name | 2-(hydroxymethyl)-N,6-dimethyl-5-methylsulfonyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 70514154 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-(hydroxymethyl)-N,6-dimethyl-5-methylsulfonyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxamide |
| SMILES | CNC(=O)C1=C(CO)NC(C)=C(S(C)(=O)=O)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O6S/c1-9-15(26(3,24)25)13(10-6-4-5-7-12(10)19(22)23)14(16(21)17-2)11(8-20)18-9/h4-7,13,18,20H,8H2,1-3H3,(H,17,21) |
| InChIKey | CGBIVOIOWQYLLL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|