C24H32N2O12S — CID 70602478
2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 5-ethylsulfonyl-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70602478) has the molecular formula C24H32N2O12S and a molecular weight of 572.59 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 5-ethylsulfonyl-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 5-ethylsulfonyl-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70602478 |
| Molecular Formula | C24H32N2O12S |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | 2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl 5-ethylsulfonyl-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCS(=O)(=O)C1=C(C)NC(C)=C(C(=O)OCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H32N2O12S/c1-4-39(34,35)22-13(3)25-12(2)17(18(22)14-7-5-6-8-15(14)26(32)33)23(31)36-9-10-37-24-21(30)20(29)19(28)16(11-27)38-24/h5-8,16,18-21,24-25,27-30H,4,9-11H2,1-3H3/t16-,18?,19-,20+,21-,24+/m1/s1 |
| InChIKey | ZRDRQESNYXWXTP-NMAVGURCSA-N |
| XLogP | -0.42 |
| TPSA | 214.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|