C28H36N2O12 — CID 70603358
5-O-cyclopentyl 3-O-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 70603358) has the molecular formula C28H36N2O12 and a molecular weight of 592.60 g/mol. Its IUPAC name is 5-O-cyclopentyl 3-O-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-cyclopentyl 3-O-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 70603358 |
| Molecular Formula | C28H36N2O12 |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 5-O-cyclopentyl 3-O-[2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl] 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(c2ccccc2[N+](=O)[O-])C(C(=O)OC2CCCC2)=C(C)N1 |
| InChI | InChI=1S/C28H36N2O12/c1-14-20(26(35)39-11-12-40-28-25(34)24(33)23(32)19(13-31)42-28)22(17-9-5-6-10-18(17)30(37)38)21(15(2)29-14)27(36)41-16-7-3-4-8-16/h5-6,9-10,16,19,22-25,28-29,31-34H,3-4,7-8,11-13H2,1-2H3/t19-,22?,23-,24+,25-,28+/m1/s1 |
| InChIKey | SBBXWVBIFRVKRQ-WRNNRKCKSA-N |
| XLogP | 0.68 |
| TPSA | 207.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|