C23H28N2O8S — CID 70616152
cyclopentyl [2,6-dimethyl-5-(2-methylsulfanylethoxycarbonyloxy)-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] carbonate (PubChem CID 70616152) has the molecular formula C23H28N2O8S and a molecular weight of 492.55 g/mol. Its IUPAC name is cyclopentyl [2,6-dimethyl-5-(2-methylsulfanylethoxycarbonyloxy)-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] carbonate.
| Compound Name | cyclopentyl [2,6-dimethyl-5-(2-methylsulfanylethoxycarbonyloxy)-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 70616152 |
| Molecular Formula | C23H28N2O8S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | cyclopentyl [2,6-dimethyl-5-(2-methylsulfanylethoxycarbonyloxy)-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] carbonate |
| SMILES | CSCCOC(=O)OC1=C(C)NC(C)=C(OC(=O)OC2CCCC2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H28N2O8S/c1-14-20(32-22(26)30-12-13-34-3)19(17-10-6-7-11-18(17)25(28)29)21(15(2)24-14)33-23(27)31-16-8-4-5-9-16/h6-7,10-11,16,19,24H,4-5,8-9,12-13H2,1-3H3 |
| InChIKey | ISHTWNGBKBPINW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|