C22H24N2O7 — CID 67907025
methyl [2-methyl-4-(2-nitrophenyl)-5-oxospiro[4,8-dihydro-1H-pyrano[4,3-b]pyridine-7,1'-cyclohexane]-3-yl] carbonate (PubChem CID 67907025) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is methyl [2-methyl-4-(2-nitrophenyl)-5-oxospiro[4,8-dihydro-1H-pyrano[4,3-b]pyridine-7,1'-cyclohexane]-3-yl] carbonate.
| Compound Name | methyl [2-methyl-4-(2-nitrophenyl)-5-oxospiro[4,8-dihydro-1H-pyrano[4,3-b]pyridine-7,1'-cyclohexane]-3-yl] carbonate |
|---|---|
| PubChem CID | 67907025 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | methyl [2-methyl-4-(2-nitrophenyl)-5-oxospiro[4,8-dihydro-1H-pyrano[4,3-b]pyridine-7,1'-cyclohexane]-3-yl] carbonate |
| SMILES | COC(=O)OC1=C(C)NC2=C(C(=O)OC3(CCCCC3)C2)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O7/c1-13-19(30-21(26)29-2)17(14-8-4-5-9-16(14)24(27)28)18-15(23-13)12-22(31-20(18)25)10-6-3-7-11-22/h4-5,8-9,17,23H,3,6-7,10-12H2,1-2H3 |
| InChIKey | UXYJUEFHDFGLRL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|