C18H19ClN2O8 — CID 70517266
[5-(2-chloroethoxycarbonyloxy)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] methyl carbonate (PubChem CID 70517266) has the molecular formula C18H19ClN2O8 and a molecular weight of 426.81 g/mol. Its IUPAC name is [5-(2-chloroethoxycarbonyloxy)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] methyl carbonate.
| Compound Name | [5-(2-chloroethoxycarbonyloxy)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70517266 |
| Molecular Formula | C18H19ClN2O8 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | [5-(2-chloroethoxycarbonyloxy)-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(OC(=O)OCCCl)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19ClN2O8/c1-10-15(28-17(22)26-3)14(12-6-4-5-7-13(12)21(24)25)16(11(2)20-10)29-18(23)27-9-8-19/h4-7,14,20H,8-9H2,1-3H3 |
| InChIKey | XNGUDTKFUHVDTM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|