C20H24F2N2O6 — CID 70384268
[4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] pentyl carbonate (PubChem CID 70384268) has the molecular formula C20H24F2N2O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] pentyl carbonate.
| Compound Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] pentyl carbonate |
|---|---|
| PubChem CID | 70384268 |
| Molecular Formula | C20H24F2N2O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)OC1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1OC(F)F |
| InChI | InChI=1S/C20H24F2N2O6/c1-4-5-8-11-28-20(25)30-18-13(3)23-12(2)17(24(26)27)16(18)14-9-6-7-10-15(14)29-19(21)22/h6-7,9-10,16,19,23H,4-5,8,11H2,1-3H3 |
| InChIKey | HCYKHTCVICHTGM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|