C21H26F2N2O7 — CID 70384112
[4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 6-hydroxyhexyl carbonate (PubChem CID 70384112) has the molecular formula C21H26F2N2O7 and a molecular weight of 456.44 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 6-hydroxyhexyl carbonate.
| Compound Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 6-hydroxyhexyl carbonate |
|---|---|
| PubChem CID | 70384112 |
| Molecular Formula | C21H26F2N2O7 |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] 6-hydroxyhexyl carbonate |
| SMILES | CC1=C(OC(=O)OCCCCCCO)C(c2ccccc2OC(F)F)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C21H26F2N2O7/c1-13-18(25(28)29)17(15-9-5-6-10-16(15)31-20(22)23)19(14(2)24-13)32-21(27)30-12-8-4-3-7-11-26/h5-6,9-10,17,20,24,26H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | LSVGPPRAUOKWGS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|