C25H26F2N2O6 — CID 70385181
[4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] (2-methyl-1-phenylpropan-2-yl) carbonate (PubChem CID 70385181) has the molecular formula C25H26F2N2O6 and a molecular weight of 488.49 g/mol. Its IUPAC name is [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] (2-methyl-1-phenylpropan-2-yl) carbonate.
| Compound Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] (2-methyl-1-phenylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 70385181 |
| Molecular Formula | C25H26F2N2O6 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [4-[2-(difluoromethoxy)phenyl]-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] (2-methyl-1-phenylpropan-2-yl) carbonate |
| SMILES | CC1=C(OC(=O)OC(C)(C)Cc2ccccc2)C(c2ccccc2OC(F)F)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C25H26F2N2O6/c1-15-21(29(31)32)20(18-12-8-9-13-19(18)33-23(26)27)22(16(2)28-15)34-24(30)35-25(3,4)14-17-10-6-5-7-11-17/h5-13,20,23,28H,14H2,1-4H3 |
| InChIKey | QXZLXVAXNXEUJQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|