C26H31N3O6 — CID 70380485
5-aminopentyl [2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridin-3-yl] carbonate (PubChem CID 70380485) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is 5-aminopentyl [2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridin-3-yl] carbonate.
| Compound Name | 5-aminopentyl [2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridin-3-yl] carbonate |
|---|---|
| PubChem CID | 70380485 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 5-aminopentyl [2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridin-3-yl] carbonate |
| SMILES | CC1=C(OC(=O)OCCCCCN)C(c2ccccc2OCc2ccccc2)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C26H31N3O6/c1-18-24(29(31)32)23(25(19(2)28-18)35-26(30)33-16-10-4-9-15-27)21-13-7-8-14-22(21)34-17-20-11-5-3-6-12-20/h3,5-8,11-14,23,28H,4,9-10,15-17,27H2,1-2H3 |
| InChIKey | HFIDPOHLXCYWEM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|