C22H22N2O5S — CID 70352309
[4-(2-benzylsulfanylphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] methyl carbonate (PubChem CID 70352309) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is [4-(2-benzylsulfanylphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] methyl carbonate.
| Compound Name | [4-(2-benzylsulfanylphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70352309 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [4-(2-benzylsulfanylphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1SCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5S/c1-14-20(24(26)27)19(21(15(2)23-14)29-22(25)28-3)17-11-7-8-12-18(17)30-13-16-9-5-4-6-10-16/h4-12,19,23H,13H2,1-3H3 |
| InChIKey | KLMJWBVUSGIPMH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|