C19H19F3N2O9 — CID 70471553
[2,6-dimethyl-5-(2-nitrooxyethoxycarbonyloxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] methyl carbonate (PubChem CID 70471553) has the molecular formula C19H19F3N2O9 and a molecular weight of 476.36 g/mol. Its IUPAC name is [2,6-dimethyl-5-(2-nitrooxyethoxycarbonyloxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] methyl carbonate.
| Compound Name | [2,6-dimethyl-5-(2-nitrooxyethoxycarbonyloxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 70471553 |
| Molecular Formula | C19H19F3N2O9 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [2,6-dimethyl-5-(2-nitrooxyethoxycarbonyloxy)-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] methyl carbonate |
| SMILES | COC(=O)OC1=C(C)NC(C)=C(OC(=O)OCCO[N+](=O)[O-])C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O9/c1-10-15(32-17(25)29-3)14(12-6-4-5-7-13(12)19(20,21)22)16(11(2)23-10)33-18(26)30-8-9-31-24(27)28/h4-7,14,23H,8-9H2,1-3H3 |
| InChIKey | LRJVGRDOBQRARB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|