C28H28F3NO8 — CID 70598897
2-[[2,6-dimethyl-5-propan-2-yloxycarbonyloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl]oxycarbonyloxy]ethyl benzoate (PubChem CID 70598897) has the molecular formula C28H28F3NO8 and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-[[2,6-dimethyl-5-propan-2-yloxycarbonyloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl]oxycarbonyloxy]ethyl benzoate.
| Compound Name | 2-[[2,6-dimethyl-5-propan-2-yloxycarbonyloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl]oxycarbonyloxy]ethyl benzoate |
|---|---|
| PubChem CID | 70598897 |
| Molecular Formula | C28H28F3NO8 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | 2-[[2,6-dimethyl-5-propan-2-yloxycarbonyloxy-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl]oxycarbonyloxy]ethyl benzoate |
| SMILES | CC1=C(OC(=O)OCCOC(=O)c2ccccc2)C(c2ccccc2C(F)(F)F)C(OC(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C28H28F3NO8/c1-16(2)38-27(35)40-24-18(4)32-17(3)23(22(24)20-12-8-9-13-21(20)28(29,30)31)39-26(34)37-15-14-36-25(33)19-10-6-5-7-11-19/h5-13,16,22,32H,14-15H2,1-4H3 |
| InChIKey | UWMAVTMVIBXAEC-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|