About [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate
[5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate (PubChem CID 70571986) has the molecular formula C27H20F3NO4
and a molecular weight of 479.45 g/mol. Its IUPAC name is [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate |
| PubChem CID | 70571986 |
| Molecular Formula | C27H20F3NO4 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate |
| SMILES | CC1=C(OC(=O)O)C(c2ccccc2C(F)(F)F)C(C(=O)c2ccccc2)=C(c2ccccc2)N1 |
| InChI | InChI=1S/C27H20F3NO4/c1-16-25(35-26(33)34)21(19-14-8-9-15-20(19)27(28,29)30)22(24(32)18-12-6-3-7-13-18)23(31-16)17-10-4-2-5-11-17/h2-15,21,31H,1H3,(H,33,34) |
| InChIKey | LSTBNHAWXJENMX-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate?
The IUPAC name of [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate (CID 70571986) is [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate.
What is the SMILES notation for [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate?
The canonical SMILES for [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate is CC1=C(OC(=O)O)C(c2ccccc2C(F)(F)F)C(C(=O)c2ccccc2)=C(c2ccccc2)N1.
What is the InChIKey of [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate?
The InChIKey is LSTBNHAWXJENMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20F3NO4/c1-16-25(35-26(33)34)21(19-14-8-9-15-20(19)27(28,29)30)22(24(32)18-12-6-3-7-13-18)23(31-16)17-10-4-2-5-11-17/h2-15,21,31H,1H3,(H,33,34).
What are the key properties of [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate?
[5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate has a molecular weight of 479.45 g/mol, XLogP of 6.61, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-benzoyl-2-methyl-6-phenyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-yl] hydrogen carbonate is sourced from PubChem (CID 70571986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).