C19H15F3N2OS — CID 8651952
1-[(4S)-6-phenyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 8651952) has the molecular formula C19H15F3N2OS and a molecular weight of 376.40 g/mol. Its IUPAC name is 1-[(4S)-6-phenyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4S)-6-phenyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 8651952 |
| Molecular Formula | C19H15F3N2OS |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[(4S)-6-phenyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccccc2)NC(=S)N[C@H]1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H15F3N2OS/c1-11(25)15-16(12-7-3-2-4-8-12)23-18(26)24-17(15)13-9-5-6-10-14(13)19(20,21)22/h2-10,17H,1H3,(H2,23,24,26)/t17-/m0/s1 |
| InChIKey | CBDJETREXDKZGE-KRWDZBQOSA-N |
| XLogP | 4.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|