C18H13ClF2N2OS — CID 8651628
1-[(4R)-6-(4-chlorophenyl)-4-(2,6-difluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 8651628) has the molecular formula C18H13ClF2N2OS and a molecular weight of 378.83 g/mol. Its IUPAC name is 1-[(4R)-6-(4-chlorophenyl)-4-(2,6-difluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4R)-6-(4-chlorophenyl)-4-(2,6-difluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 8651628 |
| Molecular Formula | C18H13ClF2N2OS |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-[(4R)-6-(4-chlorophenyl)-4-(2,6-difluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccc(Cl)cc2)NC(=S)N[C@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C18H13ClF2N2OS/c1-9(24)14-16(10-5-7-11(19)8-6-10)22-18(25)23-17(14)15-12(20)3-2-4-13(15)21/h2-8,17H,1H3,(H2,22,23,25)/t17-/m1/s1 |
| InChIKey | PASZVUDXKOOYBX-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|