C19H13F3N2O3S — CID 9071509
methyl 2-[(4S)-4-(2,6-difluorophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate (PubChem CID 9071509) has the molecular formula C19H13F3N2O3S and a molecular weight of 406.39 g/mol. Its IUPAC name is methyl 2-[(4S)-4-(2,6-difluorophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(4S)-4-(2,6-difluorophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 9071509 |
| Molecular Formula | C19H13F3N2O3S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | methyl 2-[(4S)-4-(2,6-difluorophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1=C(c2ccc(F)cc2)NC(=S)N[C@@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C19H13F3N2O3S/c1-27-18(26)17(25)14-15(9-5-7-10(20)8-6-9)23-19(28)24-16(14)13-11(21)3-2-4-12(13)22/h2-8,16H,1H3,(H2,23,24,28)/t16-/m1/s1 |
| InChIKey | BUDGCEQZPVPCSQ-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|