C18H14ClFN2OS — CID 8651923
1-[(4R)-4-(2-chloro-6-fluorophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 8651923) has the molecular formula C18H14ClFN2OS and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-[(4R)-4-(2-chloro-6-fluorophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4R)-4-(2-chloro-6-fluorophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 8651923 |
| Molecular Formula | C18H14ClFN2OS |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 1-[(4R)-4-(2-chloro-6-fluorophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccccc2)NC(=S)N[C@H]1c1c(F)cccc1Cl |
| InChI | InChI=1S/C18H14ClFN2OS/c1-10(23)14-16(11-6-3-2-4-7-11)21-18(24)22-17(14)15-12(19)8-5-9-13(15)20/h2-9,17H,1H3,(H2,21,22,24)/t17-/m1/s1 |
| InChIKey | GECKJGHJMIOMMS-QGZVFWFLSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|