C22H21FN2O6S — CID 10139456
methyl 4-(4-acetyloxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 10139456) has the molecular formula C22H21FN2O6S and a molecular weight of 460.48 g/mol. Its IUPAC name is methyl 4-(4-acetyloxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-(4-acetyloxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 10139456 |
| Molecular Formula | C22H21FN2O6S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | methyl 4-(4-acetyloxy-3,5-dimethoxyphenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(c2ccc(F)cc2)NC(=S)NC1c1cc(OC)c(OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C22H21FN2O6S/c1-11(26)31-20-15(28-2)9-13(10-16(20)29-3)19-17(21(27)30-4)18(24-22(32)25-19)12-5-7-14(23)8-6-12/h5-10,19H,1-4H3,(H2,24,25,32) |
| InChIKey | AKXJWACRLSDEEJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|