C20H17FN2O3S — CID 8652571
methyl 4-[(4S)-5-acetyl-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate (PubChem CID 8652571) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 4-[(4S)-5-acetyl-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate.
| Compound Name | methyl 4-[(4S)-5-acetyl-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 8652571 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | methyl 4-[(4S)-5-acetyl-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2NC(=S)NC(c3ccc(F)cc3)=C2C(C)=O)cc1 |
| InChI | InChI=1S/C20H17FN2O3S/c1-11(24)16-17(12-3-5-14(6-4-12)19(25)26-2)22-20(27)23-18(16)13-7-9-15(21)10-8-13/h3-10,17H,1-2H3,(H2,22,23,27)/t17-/m0/s1 |
| InChIKey | PULZLLOYULFZLE-KRWDZBQOSA-N |
| XLogP | 3.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|