C24H21N4O3S+ — CID 5215973
methyl 4-[6-phenyl-5-(pyridin-1-ium-2-ylcarbamoyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate (PubChem CID 5215973) has the molecular formula C24H21N4O3S+ and a molecular weight of 445.52 g/mol. Its IUPAC name is methyl 4-[6-phenyl-5-(pyridin-1-ium-2-ylcarbamoyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate.
| Compound Name | methyl 4-[6-phenyl-5-(pyridin-1-ium-2-ylcarbamoyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 5215973 |
| Molecular Formula | C24H21N4O3S+ |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | methyl 4-[6-phenyl-5-(pyridin-1-ium-2-ylcarbamoyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(=S)NC(c3ccccc3)=C2C(=O)Nc2cccc[nH+]2)cc1 |
| InChI | InChI=1S/C24H20N4O3S/c1-31-23(30)17-12-10-16(11-13-17)21-19(22(29)26-18-9-5-6-14-25-18)20(27-24(32)28-21)15-7-3-2-4-8-15/h2-14,21H,1H3,(H,25,26,29)(H2,27,28,32)/p+1 |
| InChIKey | WBLBYIQUPQARDK-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 93.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|