C27H27N3OS — CID 142163498
4-[4-(2-methylpropyl)phenyl]-N,6-diphenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 142163498) has the molecular formula C27H27N3OS and a molecular weight of 441.60 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)phenyl]-N,6-diphenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-[4-(2-methylpropyl)phenyl]-N,6-diphenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 142163498 |
| Molecular Formula | C27H27N3OS |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-[4-(2-methylpropyl)phenyl]-N,6-diphenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC(C)Cc1ccc(C2NC(=S)NC(c3ccccc3)=C2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27N3OS/c1-18(2)17-19-13-15-21(16-14-19)25-23(26(31)28-22-11-7-4-8-12-22)24(29-27(32)30-25)20-9-5-3-6-10-20/h3-16,18,25H,17H2,1-2H3,(H,28,31)(H2,29,30,32) |
| InChIKey | GHFWDWJWOSVRFB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|