C21H19FN2O2S — CID 9069820
1-[(4R)-6-(4-fluorophenyl)-4-(3-prop-2-enoxyphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 9069820) has the molecular formula C21H19FN2O2S and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[(4R)-6-(4-fluorophenyl)-4-(3-prop-2-enoxyphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4R)-6-(4-fluorophenyl)-4-(3-prop-2-enoxyphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 9069820 |
| Molecular Formula | C21H19FN2O2S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[(4R)-6-(4-fluorophenyl)-4-(3-prop-2-enoxyphenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | C=CCOc1cccc([C@H]2NC(=S)NC(c3ccc(F)cc3)=C2C(C)=O)c1 |
| InChI | InChI=1S/C21H19FN2O2S/c1-3-11-26-17-6-4-5-15(12-17)20-18(13(2)25)19(23-21(27)24-20)14-7-9-16(22)10-8-14/h3-10,12,20H,1,11H2,2H3,(H2,23,24,27)/t20-/m1/s1 |
| InChIKey | SCHNTTMVKQPBEH-HXUWFJFHSA-N |
| XLogP | 3.91 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|