C18H13ClFN3O3S — CID 8652566
1-[(4R)-4-(4-chloro-3-nitrophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 8652566) has the molecular formula C18H13ClFN3O3S and a molecular weight of 405.84 g/mol. Its IUPAC name is 1-[(4R)-4-(4-chloro-3-nitrophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4R)-4-(4-chloro-3-nitrophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 8652566 |
| Molecular Formula | C18H13ClFN3O3S |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 1-[(4R)-4-(4-chloro-3-nitrophenyl)-6-(4-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccc(F)cc2)NC(=S)N[C@@H]1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13ClFN3O3S/c1-9(24)15-16(10-2-5-12(20)6-3-10)21-18(27)22-17(15)11-4-7-13(19)14(8-11)23(25)26/h2-8,17H,1H3,(H2,21,22,27)/t17-/m1/s1 |
| InChIKey | CGZIDHIRHOUONV-QGZVFWFLSA-N |
| XLogP | 3.91 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|