C15H16ClN3O4S — CID 8652456
methyl (4S)-4-(4-chloro-3-nitrophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 8652456) has the molecular formula C15H16ClN3O4S and a molecular weight of 369.83 g/mol. Its IUPAC name is methyl (4S)-4-(4-chloro-3-nitrophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-(4-chloro-3-nitrophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8652456 |
| Molecular Formula | C15H16ClN3O4S |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | methyl (4S)-4-(4-chloro-3-nitrophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC1=C(C(=O)OC)[C@H](c2ccc(Cl)c([N+](=O)[O-])c2)NC(=S)N1 |
| InChI | InChI=1S/C15H16ClN3O4S/c1-3-4-10-12(14(20)23-2)13(18-15(24)17-10)8-5-6-9(16)11(7-8)19(21)22/h5-7,13H,3-4H2,1-2H3,(H2,17,18,24)/t13-/m0/s1 |
| InChIKey | LPUHEMMUQQUJDD-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|