C19H16ClN3O4S — CID 1297413
ethyl (4R)-4-(4-chloro-3-nitrophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 1297413) has the molecular formula C19H16ClN3O4S and a molecular weight of 417.87 g/mol. Its IUPAC name is ethyl (4R)-4-(4-chloro-3-nitrophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-(4-chloro-3-nitrophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 1297413 |
| Molecular Formula | C19H16ClN3O4S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl (4R)-4-(4-chloro-3-nitrophenyl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(=S)N[C@@H]1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClN3O4S/c1-2-27-18(24)15-16(11-6-4-3-5-7-11)21-19(28)22-17(15)12-8-9-13(20)14(10-12)23(25)26/h3-10,17H,2H2,1H3,(H2,21,22,28)/t17-/m1/s1 |
| InChIKey | VLYFVRCSFKTVID-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|