C24H22N2O3S — CID 8871562
ethyl (4R)-4-(6-methoxynaphthalen-2-yl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 8871562) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl (4R)-4-(6-methoxynaphthalen-2-yl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-(6-methoxynaphthalen-2-yl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8871562 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | ethyl (4R)-4-(6-methoxynaphthalen-2-yl)-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC(=S)N[C@@H]1c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-3-29-23(27)20-21(15-7-5-4-6-8-15)25-24(30)26-22(20)18-10-9-17-14-19(28-2)12-11-16(17)13-18/h4-14,22H,3H2,1-2H3,(H2,25,26,30)/t22-/m1/s1 |
| InChIKey | ZIWJRZJNCNOHSF-JOCHJYFZSA-N |
| XLogP | 4.34 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|