C16H17F3N2O2S — CID 8652450
methyl (4R)-6-propyl-2-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 8652450) has the molecular formula C16H17F3N2O2S and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (4R)-6-propyl-2-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-6-propyl-2-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8652450 |
| Molecular Formula | C16H17F3N2O2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | methyl (4R)-6-propyl-2-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC1=C(C(=O)OC)[C@@H](c2cccc(C(F)(F)F)c2)NC(=S)N1 |
| InChI | InChI=1S/C16H17F3N2O2S/c1-3-5-11-12(14(22)23-2)13(21-15(24)20-11)9-6-4-7-10(8-9)16(17,18)19/h4,6-8,13H,3,5H2,1-2H3,(H2,20,21,24)/t13-/m1/s1 |
| InChIKey | WHNBKXZEBLTOLR-CYBMUJFWSA-N |
| XLogP | 3.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|