C20H28N2O2S — CID 51109707
ethyl 4-(4-tert-butylphenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 51109707) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is ethyl 4-(4-tert-butylphenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-tert-butylphenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 51109707 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethyl 4-(4-tert-butylphenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)C(c2ccc(C(C)(C)C)cc2)NC(=S)N1 |
| InChI | InChI=1S/C20H28N2O2S/c1-6-8-15-16(18(23)24-7-2)17(22-19(25)21-15)13-9-11-14(12-10-13)20(3,4)5/h9-12,17H,6-8H2,1-5H3,(H2,21,22,25) |
| InChIKey | SAPGDAXZRDRLQO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|