C16H18BrFN2O2S — CID 8651586
ethyl (4R)-4-(3-bromo-4-fluorophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 8651586) has the molecular formula C16H18BrFN2O2S and a molecular weight of 401.30 g/mol. Its IUPAC name is ethyl (4R)-4-(3-bromo-4-fluorophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-(3-bromo-4-fluorophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 8651586 |
| Molecular Formula | C16H18BrFN2O2S |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | ethyl (4R)-4-(3-bromo-4-fluorophenyl)-6-propyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2ccc(F)c(Br)c2)NC(=S)N1 |
| InChI | InChI=1S/C16H18BrFN2O2S/c1-3-5-12-13(15(21)22-4-2)14(20-16(23)19-12)9-6-7-11(18)10(17)8-9/h6-8,14H,3-5H2,1-2H3,(H2,19,20,23)/t14-/m1/s1 |
| InChIKey | BFMZEVHOZRQEGX-CQSZACIVSA-N |
| XLogP | 3.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|