C14H12F4N2O2S — CID 3923271
ethyl 4-(4-fluorophenyl)-2-sulfanylidene-6-(trifluoromethyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 3923271) has the molecular formula C14H12F4N2O2S and a molecular weight of 348.32 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-sulfanylidene-6-(trifluoromethyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-sulfanylidene-6-(trifluoromethyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 3923271 |
| Molecular Formula | C14H12F4N2O2S |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-sulfanylidene-6-(trifluoromethyl)-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)NC(=S)NC1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H12F4N2O2S/c1-2-22-12(21)9-10(7-3-5-8(15)6-4-7)19-13(23)20-11(9)14(16,17)18/h3-6,10H,2H2,1H3,(H2,19,20,23) |
| InChIKey | RENOLBGQZNCYPE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|