C23H20N2OS — CID 9070174
1-[(4S)-6-(4-methylphenyl)-4-naphthalen-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 9070174) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-[(4S)-6-(4-methylphenyl)-4-naphthalen-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[(4S)-6-(4-methylphenyl)-4-naphthalen-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 9070174 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 1-[(4S)-6-(4-methylphenyl)-4-naphthalen-2-yl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(c2ccc(C)cc2)NC(=S)N[C@H]1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H20N2OS/c1-14-7-9-17(10-8-14)21-20(15(2)26)22(25-23(27)24-21)19-12-11-16-5-3-4-6-18(16)13-19/h3-13,22H,1-2H3,(H2,24,25,27)/t22-/m0/s1 |
| InChIKey | REQNKYWYYNZWPB-QFIPXVFZSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|