C19H14ClFN2O3S — CID 11936322
methyl 2-[(4S)-4-(2-chlorophenyl)-6-(2-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate (PubChem CID 11936322) has the molecular formula C19H14ClFN2O3S and a molecular weight of 404.85 g/mol. Its IUPAC name is methyl 2-[(4S)-4-(2-chlorophenyl)-6-(2-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate.
| Compound Name | methyl 2-[(4S)-4-(2-chlorophenyl)-6-(2-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 11936322 |
| Molecular Formula | C19H14ClFN2O3S |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | methyl 2-[(4S)-4-(2-chlorophenyl)-6-(2-fluorophenyl)-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)C1=C(c2ccccc2F)NC(=S)N[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C19H14ClFN2O3S/c1-26-18(25)17(24)14-15(10-6-2-4-8-12(10)20)22-19(27)23-16(14)11-7-3-5-9-13(11)21/h2-9,15H,1H3,(H2,22,23,27)/t15-/m1/s1 |
| InChIKey | AMVZTMLNKSBLFY-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|