C22H17ClN2S — CID 45112483
4-(2-chlorophenyl)-5,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 45112483) has the molecular formula C22H17ClN2S and a molecular weight of 376.91 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-5,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 4-(2-chlorophenyl)-5,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 45112483 |
| Molecular Formula | C22H17ClN2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 4-(2-chlorophenyl)-5,6-diphenyl-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | S=C1NC(c2ccccc2)=C(c2ccccc2)C(c2ccccc2Cl)N1 |
| InChI | InChI=1S/C22H17ClN2S/c23-18-14-8-7-13-17(18)21-19(15-9-3-1-4-10-15)20(24-22(26)25-21)16-11-5-2-6-12-16/h1-14,21H,(H2,24,25,26) |
| InChIKey | YJGLAJNCYPERIX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|