C24H25N3O6 — CID 70599384
[5-(2-cyanoethoxycarbonyloxy)-2,6-dimethyl-4-quinolin-4-yl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate (PubChem CID 70599384) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is [5-(2-cyanoethoxycarbonyloxy)-2,6-dimethyl-4-quinolin-4-yl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate.
| Compound Name | [5-(2-cyanoethoxycarbonyloxy)-2,6-dimethyl-4-quinolin-4-yl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 70599384 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [5-(2-cyanoethoxycarbonyloxy)-2,6-dimethyl-4-quinolin-4-yl-1,4-dihydropyridin-3-yl] propan-2-yl carbonate |
| SMILES | CC1=C(OC(=O)OCCC#N)C(c2ccnc3ccccc23)C(OC(=O)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C24H25N3O6/c1-14(2)31-24(29)33-22-16(4)27-15(3)21(32-23(28)30-13-7-11-25)20(22)18-10-12-26-19-9-6-5-8-17(18)19/h5-6,8-10,12,14,20,27H,7,13H2,1-4H3 |
| InChIKey | ZPRGTRXWORLKNV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|