C17H20F3N3O7 — CID 163148840
(4R)-N-hydroxy-5-[2-[hydroxy(oxido)azaniumyl]oxyethoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-amine oxide (PubChem CID 163148840) has the molecular formula C17H20F3N3O7 and a molecular weight of 435.36 g/mol. Its IUPAC name is (4R)-N-hydroxy-5-[2-[hydroxy(oxido)azaniumyl]oxyethoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-amine oxide.
| Compound Name | (4R)-N-hydroxy-5-[2-[hydroxy(oxido)azaniumyl]oxyethoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-amine oxide |
|---|---|
| PubChem CID | 163148840 |
| Molecular Formula | C17H20F3N3O7 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (4R)-N-hydroxy-5-[2-[hydroxy(oxido)azaniumyl]oxyethoxycarbonyl]-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridin-3-amine oxide |
| SMILES | CC1=C(C(=O)OCCO[NH+]([O-])O)[C@@H](c2ccccc2C(F)(F)F)C([NH+]([O-])O)=C(C)N1 |
| InChI | InChI=1S/C17H20F3N3O7/c1-9-13(16(24)29-7-8-30-23(27)28)14(15(22(25)26)10(2)21-9)11-5-3-4-6-12(11)17(18,19)20/h3-6,14,21-23,25,27H,7-8H2,1-2H3/t14-/m1/s1 |
| InChIKey | GEYIVXHAGMXLSZ-CQSZACIVSA-N |
| XLogP | -0.08 |
| TPSA | 143.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|