C15H14F3N2O4- — CID 163116856
(4R)-5-(dihydroxyamino)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 163116856) has the molecular formula C15H14F3N2O4- and a molecular weight of 343.28 g/mol. Its IUPAC name is (4R)-5-(dihydroxyamino)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | (4R)-5-(dihydroxyamino)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 163116856 |
| Molecular Formula | C15H14F3N2O4- |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (4R)-5-(dihydroxyamino)-2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)[O-])[C@@H](c2ccccc2C(F)(F)F)C(N(O)O)=C(C)N1 |
| InChI | InChI=1S/C15H15F3N2O4/c1-7-11(14(21)22)12(13(20(23)24)8(2)19-7)9-5-3-4-6-10(9)15(16,17)18/h3-6,12,19,23-24H,1-2H3,(H,21,22)/p-1/t12-/m1/s1 |
| InChIKey | RSPNSLRXLFCWGR-GFCCVEGCSA-M |
| XLogP | 1.73 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|