C24H23F3N2O5 — CID 22839340
[(2S)-2-methoxy-2-phenylethyl] 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 22839340) has the molecular formula C24H23F3N2O5 and a molecular weight of 476.45 g/mol. Its IUPAC name is [(2S)-2-methoxy-2-phenylethyl] 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | [(2S)-2-methoxy-2-phenylethyl] 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 22839340 |
| Molecular Formula | C24H23F3N2O5 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [(2S)-2-methoxy-2-phenylethyl] 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | CO[C@H](COC(=O)C1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H23F3N2O5/c1-14-20(23(30)34-13-19(33-3)16-9-5-4-6-10-16)21(22(29(31)32)15(2)28-14)17-11-7-8-12-18(17)24(25,26)27/h4-12,19,21,28H,13H2,1-3H3/t19-,21?/m1/s1 |
| InChIKey | HUFRPUYKCIGGJN-YMBRHYMPSA-N |
| XLogP | 5.11 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|