C25H24Cl2F3N5O5 — CID 91799378
N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 91799378) has the molecular formula C25H24Cl2F3N5O5 and a molecular weight of 602.40 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 91799378 |
| Molecular Formula | C25H24Cl2F3N5O5 |
| Molecular Weight | 602.40 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide;methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1C(F)(F)F.NC(N)=NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H15F3N2O4.C9H9Cl2N3O/c1-8-12(15(22)25-3)13(14(21(23)24)9(2)20-8)10-6-4-5-7-11(10)16(17,18)19;10-6-2-1-3-7(11)5(6)4-8(15)14-9(12)13/h4-7,13,20H,1-3H3;1-3H,4H2,(H4,12,13,14,15) |
| InChIKey | MGEWKEABUKQRKR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|