C26H23F3N4O5 — CID 14230413
[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 14230413) has the molecular formula C26H23F3N4O5 and a molecular weight of 528.49 g/mol. Its IUPAC name is [4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | [4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 14230413 |
| Molecular Formula | C26H23F3N4O5 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccc(C3=NNC(=O)CC3)cc2)C(c2ccccc2C(F)(F)F)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C26H23F3N4O5/c1-14-22(25(35)38-13-16-7-9-17(10-8-16)20-11-12-21(34)32-31-20)23(24(33(36)37)15(2)30-14)18-5-3-4-6-19(18)26(27,28)29/h3-10,23,30H,11-13H2,1-2H3,(H,32,34) |
| InChIKey | FTPIMMVBTLJOOI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|