C20H17N5O5 — CID 134105925
pyridin-4-ylmethyl (4S)-4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate (PubChem CID 134105925) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is pyridin-4-ylmethyl (4S)-4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate.
| Compound Name | pyridin-4-ylmethyl (4S)-4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 134105925 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | pyridin-4-ylmethyl (4S)-4-(2,1,3-benzoxadiazol-4-yl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccncc2)[C@H](c2cccc3nonc23)C([N+](=O)[O-])=C(C)N1 |
| InChI | InChI=1S/C20H17N5O5/c1-11-16(20(26)29-10-13-6-8-21-9-7-13)17(19(25(27)28)12(2)22-11)14-4-3-5-15-18(14)24-30-23-15/h3-9,17,22H,10H2,1-2H3/t17-/m0/s1 |
| InChIKey | IQAGBBZPAPLXPM-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|