C17H15N3O6 — CID 88690506
dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 88690506) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 88690506 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | dimethyl 4-(2,1,3-benzoxadiazol-4-yl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C=O)=C(C(=O)OC)C1c1cccc2nonc12 |
| InChI | InChI=1S/C17H15N3O6/c1-8-12(16(22)24-2)13(14(17(23)25-3)11(7-21)18-8)9-5-4-6-10-15(9)20-26-19-10/h4-7,13,18H,1-3H3 |
| InChIKey | VASXRQBDLCXSNQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|