C28H32N2O7S — CID 88658983
[1-ethoxy-1-oxo-2-(sulfanylmethyl)butan-2-yl] 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 88658983) has the molecular formula C28H32N2O7S and a molecular weight of 540.64 g/mol. Its IUPAC name is [1-ethoxy-1-oxo-2-(sulfanylmethyl)butan-2-yl] 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | [1-ethoxy-1-oxo-2-(sulfanylmethyl)butan-2-yl] 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 88658983 |
| Molecular Formula | C28H32N2O7S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | [1-ethoxy-1-oxo-2-(sulfanylmethyl)butan-2-yl] 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C(CC)(CS)OC(=O)C1=C(C)NC(C)=C([N+](=O)[O-])C1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H32N2O7S/c1-5-28(17-38,27(32)35-6-2)37-26(31)23-18(3)29-19(4)25(30(33)34)24(23)21-14-10-11-15-22(21)36-16-20-12-8-7-9-13-20/h7-15,24,29,38H,5-6,16-17H2,1-4H3 |
| InChIKey | WBSBJFNCNWWAAF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|