C24H24N2O7 — CID 21291459
ethyl 4-(2-benzoyloxy-3-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate (PubChem CID 21291459) has the molecular formula C24H24N2O7 and a molecular weight of 452.46 g/mol. Its IUPAC name is ethyl 4-(2-benzoyloxy-3-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 4-(2-benzoyloxy-3-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 21291459 |
| Molecular Formula | C24H24N2O7 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | ethyl 4-(2-benzoyloxy-3-methoxyphenyl)-2,6-dimethyl-5-nitro-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C([N+](=O)[O-])C1c1cccc(OC)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O7/c1-5-32-24(28)19-14(2)25-15(3)21(26(29)30)20(19)17-12-9-13-18(31-4)22(17)33-23(27)16-10-7-6-8-11-16/h6-13,20,25H,5H2,1-4H3 |
| InChIKey | INGUEYZTGRXDAL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|