C38H44N2O13S — CID 70476454
3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propyl 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70476454) has the molecular formula C38H44N2O13S and a molecular weight of 768.84 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propyl 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propyl 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70476454 |
| Molecular Formula | C38H44N2O13S |
| Molecular Weight | 768.84 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | 3-[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-(acetyloxymethyl)thian-2-yl]propyl 2,6-dimethyl-5-nitro-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC(=O)OC[C@@H]1S[C@H](CCCOC(=O)C2=C(C)NC(C)=C([N+](=O)[O-])C2c2ccccc2OCc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C38H44N2O13S/c1-21-32(33(34(40(46)47)22(2)39-21)28-15-10-11-16-29(28)50-19-27-13-8-7-9-14-27)38(45)48-18-12-17-30-35(51-24(4)42)37(53-26(6)44)36(52-25(5)43)31(54-30)20-49-23(3)41/h7-11,13-16,30-31,33,35-37,39H,12,17-20H2,1-6H3/t30-,31+,33?,35+,36-,37-/m1/s1 |
| InChIKey | RVBITLOQCIGSMQ-UCOOCQFPSA-N |
| XLogP | 4.90 |
| TPSA | 195.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.84 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|